About 2-[2-(1,3-benzothiazol-2-ylsulfonyl)ethylsulfanyl]-1,3-benzoxazole
2-[2-(1,3-benzothiazol-2-ylsulfonyl)ethylsulfanyl]-1,3-benzoxazole (PubChem CID 1319216) has the molecular formula C16H12N2O3S3
and a molecular weight of 376.48 g/mol. Its IUPAC name is 2-[2-(1,3-benzothiazol-2-ylsulfonyl)ethylsulfanyl]-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-[2-(1,3-benzothiazol-2-ylsulfonyl)ethylsulfanyl]-1,3-benzoxazole |
| PubChem CID | 1319216 |
| Molecular Formula | C16H12N2O3S3 |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | 2-[2-(1,3-benzothiazol-2-ylsulfonyl)ethylsulfanyl]-1,3-benzoxazole |
| SMILES | O=S(=O)(CCSc1nc2ccccc2o1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H12N2O3S3/c19-24(20,16-18-12-6-2-4-8-14(12)23-16)10-9-22-15-17-11-5-1-3-7-13(11)21-15/h1-8H,9-10H2 |
| InChIKey | WBHULXDBAWZGRT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[2-(1,3-benzothiazol-2-ylsulfonyl)ethylsulfanyl]-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1,3-benzothiazol-2-ylsulfonyl)ethylsulfanyl]-1,3-benzoxazole?
The IUPAC name of 2-[2-(1,3-benzothiazol-2-ylsulfonyl)ethylsulfanyl]-1,3-benzoxazole (CID 1319216) is 2-[2-(1,3-benzothiazol-2-ylsulfonyl)ethylsulfanyl]-1,3-benzoxazole.
What is the SMILES notation for 2-[2-(1,3-benzothiazol-2-ylsulfonyl)ethylsulfanyl]-1,3-benzoxazole?
The canonical SMILES for 2-[2-(1,3-benzothiazol-2-ylsulfonyl)ethylsulfanyl]-1,3-benzoxazole is O=S(=O)(CCSc1nc2ccccc2o1)c1nc2ccccc2s1.
What is the InChIKey of 2-[2-(1,3-benzothiazol-2-ylsulfonyl)ethylsulfanyl]-1,3-benzoxazole?
The InChIKey is WBHULXDBAWZGRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O3S3/c19-24(20,16-18-12-6-2-4-8-14(12)23-16)10-9-22-15-17-11-5-1-3-7-13(11)21-15/h1-8H,9-10H2.
What are the key properties of 2-[2-(1,3-benzothiazol-2-ylsulfonyl)ethylsulfanyl]-1,3-benzoxazole?
2-[2-(1,3-benzothiazol-2-ylsulfonyl)ethylsulfanyl]-1,3-benzoxazole has a molecular weight of 376.48 g/mol, XLogP of 4.00, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,3-benzothiazol-2-ylsulfonyl)ethylsulfanyl]-1,3-benzoxazole is sourced from PubChem (CID 1319216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).