C23H32N6O5 — CID 131922404
(13R,16S)-16-butyl-22-methoxy-13-methyl-2-oxa-6,7,8,11,14,17-hexazatricyclo[17.3.1.16,9]tetracosa-1(22),7,9(24),19(23),20-pentaene-12,15,18-trione (PubChem CID 131922404) has the molecular formula C23H32N6O5 and a molecular weight of 472.55 g/mol. Its IUPAC name is (13R,16S)-16-butyl-22-methoxy-13-methyl-2-oxa-6,7,8,11,14,17-hexazatricyclo[17.3.1.16,9]tetracosa-1(22),7,9(24),19(23),20-pentaene-12,15,18-trione.
| Compound Name | (13R,16S)-16-butyl-22-methoxy-13-methyl-2-oxa-6,7,8,11,14,17-hexazatricyclo[17.3.1.16,9]tetracosa-1(22),7,9(24),19(23),20-pentaene-12,15,18-trione |
|---|---|
| PubChem CID | 131922404 |
| Molecular Formula | C23H32N6O5 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | (13R,16S)-16-butyl-22-methoxy-13-methyl-2-oxa-6,7,8,11,14,17-hexazatricyclo[17.3.1.16,9]tetracosa-1(22),7,9(24),19(23),20-pentaene-12,15,18-trione |
| SMILES | CCCC[C@@H]1NC(=O)c2ccc(OC)c(c2)OCCCn2cc(nn2)CNC(=O)[C@@H](C)NC1=O |
| InChI | InChI=1S/C23H32N6O5/c1-4-5-7-18-23(32)25-15(2)21(30)24-13-17-14-29(28-27-17)10-6-11-34-20-12-16(22(31)26-18)8-9-19(20)33-3/h8-9,12,14-15,18H,4-7,10-11,13H2,1-3H3,(H,24,30)(H,25,32)(H,26,31)/t15-,18+/m1/s1 |
| InChIKey | SIEGFOIWZHTSGC-QAPCUYQASA-N |
| XLogP | 1.18 |
| TPSA | 136.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |