About 5-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]-2-methylaniline
5-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]-2-methylaniline (PubChem CID 1319229) has the molecular formula C16H17ClINO2
and a molecular weight of 417.67 g/mol. Its IUPAC name is 5-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]-2-methylaniline.
Molecular Properties
| Compound Name | 5-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]-2-methylaniline |
| PubChem CID | 1319229 |
| Molecular Formula | C16H17ClINO2 |
| Molecular Weight | 417.67 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | 5-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]-2-methylaniline |
| SMILES | COc1cc(CNc2cc(Cl)ccc2C)cc(I)c1OC |
| InChI | InChI=1S/C16H17ClINO2/c1-10-4-5-12(17)8-14(10)19-9-11-6-13(18)16(21-3)15(7-11)20-2/h4-8,19H,9H2,1-3H3 |
| InChIKey | IXVDPCUPNKHACZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.67 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]-2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]-2-methylaniline?
The IUPAC name of 5-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]-2-methylaniline (CID 1319229) is 5-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]-2-methylaniline.
What is the SMILES notation for 5-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]-2-methylaniline?
The canonical SMILES for 5-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]-2-methylaniline is COc1cc(CNc2cc(Cl)ccc2C)cc(I)c1OC.
What is the InChIKey of 5-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]-2-methylaniline?
The InChIKey is IXVDPCUPNKHACZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClINO2/c1-10-4-5-12(17)8-14(10)19-9-11-6-13(18)16(21-3)15(7-11)20-2/h4-8,19H,9H2,1-3H3.
What are the key properties of 5-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]-2-methylaniline?
5-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]-2-methylaniline has a molecular weight of 417.67 g/mol, XLogP of 4.88, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]-2-methylaniline is sourced from PubChem (CID 1319229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).