C16H27N3O2 — CID 131923858
(3S,7R,8aS)-3-(cyclohexylmethyl)-7-(dimethylamino)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 131923858) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is (3S,7R,8aS)-3-(cyclohexylmethyl)-7-(dimethylamino)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (3S,7R,8aS)-3-(cyclohexylmethyl)-7-(dimethylamino)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 131923858 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | (3S,7R,8aS)-3-(cyclohexylmethyl)-7-(dimethylamino)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | CN(C)[C@@H]1C[C@H]2C(=O)N[C@@H](CC3CCCCC3)C(=O)N2C1 |
| InChI | InChI=1S/C16H27N3O2/c1-18(2)12-9-14-15(20)17-13(16(21)19(14)10-12)8-11-6-4-3-5-7-11/h11-14H,3-10H2,1-2H3,(H,17,20)/t12-,13+,14+/m1/s1 |
| InChIKey | GKUVTTWQFBDCFC-RDBSUJKOSA-N |
| XLogP | 0.99 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |