About 1-tert-butyl-3-methyl-5-[3-(1H-pyrazol-4-yl)propyl]-1,2,4-triazole
1-tert-butyl-3-methyl-5-[3-(1H-pyrazol-4-yl)propyl]-1,2,4-triazole (PubChem CID 131924771) has the molecular formula C13H21N5
and a molecular weight of 247.35 g/mol. Its IUPAC name is 1-tert-butyl-3-methyl-5-[3-(1H-pyrazol-4-yl)propyl]-1,2,4-triazole.
Molecular Properties
| Compound Name | 1-tert-butyl-3-methyl-5-[3-(1H-pyrazol-4-yl)propyl]-1,2,4-triazole |
| PubChem CID | 131924771 |
| Molecular Formula | C13H21N5 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | 1-tert-butyl-3-methyl-5-[3-(1H-pyrazol-4-yl)propyl]-1,2,4-triazole |
| SMILES | Cc1nc(CCCc2cn[nH]c2)n(C(C)(C)C)n1 |
| InChI | InChI=1S/C13H21N5/c1-10-16-12(18(17-10)13(2,3)4)7-5-6-11-8-14-15-9-11/h8-9H,5-7H2,1-4H3,(H,14,15) |
| InChIKey | RFTDCISEWWLSRJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-tert-butyl-3-methyl-5-[3-(1H-pyrazol-4-yl)propyl]-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3-methyl-5-[3-(1H-pyrazol-4-yl)propyl]-1,2,4-triazole?
The IUPAC name of 1-tert-butyl-3-methyl-5-[3-(1H-pyrazol-4-yl)propyl]-1,2,4-triazole (CID 131924771) is 1-tert-butyl-3-methyl-5-[3-(1H-pyrazol-4-yl)propyl]-1,2,4-triazole.
What is the SMILES notation for 1-tert-butyl-3-methyl-5-[3-(1H-pyrazol-4-yl)propyl]-1,2,4-triazole?
The canonical SMILES for 1-tert-butyl-3-methyl-5-[3-(1H-pyrazol-4-yl)propyl]-1,2,4-triazole is Cc1nc(CCCc2cn[nH]c2)n(C(C)(C)C)n1.
What is the InChIKey of 1-tert-butyl-3-methyl-5-[3-(1H-pyrazol-4-yl)propyl]-1,2,4-triazole?
The InChIKey is RFTDCISEWWLSRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N5/c1-10-16-12(18(17-10)13(2,3)4)7-5-6-11-8-14-15-9-11/h8-9H,5-7H2,1-4H3,(H,14,15).
What are the key properties of 1-tert-butyl-3-methyl-5-[3-(1H-pyrazol-4-yl)propyl]-1,2,4-triazole?
1-tert-butyl-3-methyl-5-[3-(1H-pyrazol-4-yl)propyl]-1,2,4-triazole has a molecular weight of 247.35 g/mol, XLogP of 2.24, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3-methyl-5-[3-(1H-pyrazol-4-yl)propyl]-1,2,4-triazole is sourced from PubChem (CID 131924771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).