C16H25ClN4 — CID 131924906
5-chloro-N-[2-(1-cyclopentylpiperidin-2-yl)ethyl]pyrimidin-2-amine (PubChem CID 131924906) has the molecular formula C16H25ClN4 and a molecular weight of 308.86 g/mol. Its IUPAC name is 5-chloro-N-[2-(1-cyclopentylpiperidin-2-yl)ethyl]pyrimidin-2-amine.
| Compound Name | 5-chloro-N-[2-(1-cyclopentylpiperidin-2-yl)ethyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 131924906 |
| Molecular Formula | C16H25ClN4 |
| Molecular Weight | 308.86 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 5-chloro-N-[2-(1-cyclopentylpiperidin-2-yl)ethyl]pyrimidin-2-amine |
| SMILES | Clc1cnc(NCCC2CCCCN2C2CCCC2)nc1 |
| InChI | InChI=1S/C16H25ClN4/c17-13-11-19-16(20-12-13)18-9-8-15-7-3-4-10-21(15)14-5-1-2-6-14/h11-12,14-15H,1-10H2,(H,18,19,20) |
| InChIKey | MWLMNLJLEJGNPL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.86 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |