About 3-ethyl-1-[(1,4,5-trimethylimidazol-2-yl)methyl]piperidine-3-carboxamide
3-ethyl-1-[(1,4,5-trimethylimidazol-2-yl)methyl]piperidine-3-carboxamide (PubChem CID 131925289) has the molecular formula C15H26N4O
and a molecular weight of 278.40 g/mol. Its IUPAC name is 3-ethyl-1-[(1,4,5-trimethylimidazol-2-yl)methyl]piperidine-3-carboxamide.
Molecular Properties
| Compound Name | 3-ethyl-1-[(1,4,5-trimethylimidazol-2-yl)methyl]piperidine-3-carboxamide |
| PubChem CID | 131925289 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 3-ethyl-1-[(1,4,5-trimethylimidazol-2-yl)methyl]piperidine-3-carboxamide |
| SMILES | CCC1(C(N)=O)CCCN(Cc2nc(C)c(C)n2C)C1 |
| InChI | InChI=1S/C15H26N4O/c1-5-15(14(16)20)7-6-8-19(10-15)9-13-17-11(2)12(3)18(13)4/h5-10H2,1-4H3,(H2,16,20) |
| InChIKey | OVRSDCVKDLSLQK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethyl-1-[(1,4,5-trimethylimidazol-2-yl)methyl]piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-[(1,4,5-trimethylimidazol-2-yl)methyl]piperidine-3-carboxamide?
The IUPAC name of 3-ethyl-1-[(1,4,5-trimethylimidazol-2-yl)methyl]piperidine-3-carboxamide (CID 131925289) is 3-ethyl-1-[(1,4,5-trimethylimidazol-2-yl)methyl]piperidine-3-carboxamide.
What is the SMILES notation for 3-ethyl-1-[(1,4,5-trimethylimidazol-2-yl)methyl]piperidine-3-carboxamide?
The canonical SMILES for 3-ethyl-1-[(1,4,5-trimethylimidazol-2-yl)methyl]piperidine-3-carboxamide is CCC1(C(N)=O)CCCN(Cc2nc(C)c(C)n2C)C1.
What is the InChIKey of 3-ethyl-1-[(1,4,5-trimethylimidazol-2-yl)methyl]piperidine-3-carboxamide?
The InChIKey is OVRSDCVKDLSLQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N4O/c1-5-15(14(16)20)7-6-8-19(10-15)9-13-17-11(2)12(3)18(13)4/h5-10H2,1-4H3,(H2,16,20).
What are the key properties of 3-ethyl-1-[(1,4,5-trimethylimidazol-2-yl)methyl]piperidine-3-carboxamide?
3-ethyl-1-[(1,4,5-trimethylimidazol-2-yl)methyl]piperidine-3-carboxamide has a molecular weight of 278.40 g/mol, XLogP of 1.51, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-[(1,4,5-trimethylimidazol-2-yl)methyl]piperidine-3-carboxamide is sourced from PubChem (CID 131925289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).