C15H17N3O — CID 131925309
5-[(2-ethyl-2,5-dihydropyrrol-1-yl)methyl]-2-(furan-2-yl)pyrimidine (PubChem CID 131925309) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is 5-[(2-ethyl-2,5-dihydropyrrol-1-yl)methyl]-2-(furan-2-yl)pyrimidine.
| Compound Name | 5-[(2-ethyl-2,5-dihydropyrrol-1-yl)methyl]-2-(furan-2-yl)pyrimidine |
|---|---|
| PubChem CID | 131925309 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 5-[(2-ethyl-2,5-dihydropyrrol-1-yl)methyl]-2-(furan-2-yl)pyrimidine |
| SMILES | CCC1C=CCN1Cc1cnc(-c2ccco2)nc1 |
| InChI | InChI=1S/C15H17N3O/c1-2-13-5-3-7-18(13)11-12-9-16-15(17-10-12)14-6-4-8-19-14/h3-6,8-10,13H,2,7,11H2,1H3 |
| InChIKey | KHVNYWDKSNHWNH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|