About N-[(2-chlorophenyl)methyl]-N,3-dihydroxy-2,2-dimethylpropanamide
N-[(2-chlorophenyl)methyl]-N,3-dihydroxy-2,2-dimethylpropanamide (PubChem CID 13192552) has the molecular formula C12H16ClNO3
and a molecular weight of 257.72 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-N,3-dihydroxy-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[(2-chlorophenyl)methyl]-N,3-dihydroxy-2,2-dimethylpropanamide |
| PubChem CID | 13192552 |
| Molecular Formula | C12H16ClNO3 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-N,3-dihydroxy-2,2-dimethylpropanamide |
| SMILES | CC(C)(CO)C(=O)N(O)Cc1ccccc1Cl |
| InChI | InChI=1S/C12H16ClNO3/c1-12(2,8-15)11(16)14(17)7-9-5-3-4-6-10(9)13/h3-6,15,17H,7-8H2,1-2H3 |
| InChIKey | PIYIYBKUWPMENA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-chlorophenyl)methyl]-N,3-dihydroxy-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-chlorophenyl)methyl]-N,3-dihydroxy-2,2-dimethylpropanamide?
The IUPAC name of N-[(2-chlorophenyl)methyl]-N,3-dihydroxy-2,2-dimethylpropanamide (CID 13192552) is N-[(2-chlorophenyl)methyl]-N,3-dihydroxy-2,2-dimethylpropanamide.
What is the SMILES notation for N-[(2-chlorophenyl)methyl]-N,3-dihydroxy-2,2-dimethylpropanamide?
The canonical SMILES for N-[(2-chlorophenyl)methyl]-N,3-dihydroxy-2,2-dimethylpropanamide is CC(C)(CO)C(=O)N(O)Cc1ccccc1Cl.
What is the InChIKey of N-[(2-chlorophenyl)methyl]-N,3-dihydroxy-2,2-dimethylpropanamide?
The InChIKey is PIYIYBKUWPMENA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClNO3/c1-12(2,8-15)11(16)14(17)7-9-5-3-4-6-10(9)13/h3-6,15,17H,7-8H2,1-2H3.
What are the key properties of N-[(2-chlorophenyl)methyl]-N,3-dihydroxy-2,2-dimethylpropanamide?
N-[(2-chlorophenyl)methyl]-N,3-dihydroxy-2,2-dimethylpropanamide has a molecular weight of 257.72 g/mol, XLogP of 2.08, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-chlorophenyl)methyl]-N,3-dihydroxy-2,2-dimethylpropanamide is sourced from PubChem (CID 13192552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).