C18H31N3O2 — CID 131925611
2-(4-ethylpiperazin-1-yl)-N-(3-hydroxy-1-adamantyl)acetamide (PubChem CID 131925611) has the molecular formula C18H31N3O2 and a molecular weight of 321.47 g/mol. Its IUPAC name is 2-(4-ethylpiperazin-1-yl)-N-(3-hydroxy-1-adamantyl)acetamide.
| Compound Name | 2-(4-ethylpiperazin-1-yl)-N-(3-hydroxy-1-adamantyl)acetamide |
|---|---|
| PubChem CID | 131925611 |
| Molecular Formula | C18H31N3O2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.24 |
| IUPAC Name | 2-(4-ethylpiperazin-1-yl)-N-(3-hydroxy-1-adamantyl)acetamide |
| SMILES | CCN1CCN(CC(=O)NC23CC4CC(CC(O)(C4)C2)C3)CC1 |
| InChI | InChI=1S/C18H31N3O2/c1-2-20-3-5-21(6-4-20)12-16(22)19-17-8-14-7-15(9-17)11-18(23,10-14)13-17/h14-15,23H,2-13H2,1H3,(H,19,22) |
| InChIKey | ZAKVIPZTYSCSBV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |