C17H23FN2O3S — CID 131926041
N-[(1-cyclopentyl-5-oxopyrrolidin-3-yl)methyl]-4-fluoro-N-methylbenzenesulfonamide (PubChem CID 131926041) has the molecular formula C17H23FN2O3S and a molecular weight of 354.45 g/mol. Its IUPAC name is N-[(1-cyclopentyl-5-oxopyrrolidin-3-yl)methyl]-4-fluoro-N-methylbenzenesulfonamide.
| Compound Name | N-[(1-cyclopentyl-5-oxopyrrolidin-3-yl)methyl]-4-fluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 131926041 |
| Molecular Formula | C17H23FN2O3S |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-[(1-cyclopentyl-5-oxopyrrolidin-3-yl)methyl]-4-fluoro-N-methylbenzenesulfonamide |
| SMILES | CN(CC1CC(=O)N(C2CCCC2)C1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H23FN2O3S/c1-19(24(22,23)16-8-6-14(18)7-9-16)11-13-10-17(21)20(12-13)15-4-2-3-5-15/h6-9,13,15H,2-5,10-12H2,1H3 |
| InChIKey | VKKWVBQFEGHFFN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |