C15H22N2O3 — CID 131926104
2-(2,8-diazaspiro[4.5]decan-2-ylmethyl)-5-methoxypyran-4-one (PubChem CID 131926104) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-(2,8-diazaspiro[4.5]decan-2-ylmethyl)-5-methoxypyran-4-one.
| Compound Name | 2-(2,8-diazaspiro[4.5]decan-2-ylmethyl)-5-methoxypyran-4-one |
|---|---|
| PubChem CID | 131926104 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 2-(2,8-diazaspiro[4.5]decan-2-ylmethyl)-5-methoxypyran-4-one |
| SMILES | COc1coc(CN2CCC3(CCNCC3)C2)cc1=O |
| InChI | InChI=1S/C15H22N2O3/c1-19-14-10-20-12(8-13(14)18)9-17-7-4-15(11-17)2-5-16-6-3-15/h8,10,16H,2-7,9,11H2,1H3 |
| InChIKey | PRGQPBGKCLPOBQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |