C23H34N2O2 — CID 131926281
N-[(4-phenyloxan-4-yl)methyl]-1-pyrrolidin-1-ylcyclohexane-1-carboxamide (PubChem CID 131926281) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is N-[(4-phenyloxan-4-yl)methyl]-1-pyrrolidin-1-ylcyclohexane-1-carboxamide.
| Compound Name | N-[(4-phenyloxan-4-yl)methyl]-1-pyrrolidin-1-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 131926281 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | N-[(4-phenyloxan-4-yl)methyl]-1-pyrrolidin-1-ylcyclohexane-1-carboxamide |
| SMILES | O=C(NCC1(c2ccccc2)CCOCC1)C1(N2CCCC2)CCCCC1 |
| InChI | InChI=1S/C23H34N2O2/c26-21(23(11-5-2-6-12-23)25-15-7-8-16-25)24-19-22(13-17-27-18-14-22)20-9-3-1-4-10-20/h1,3-4,9-10H,2,5-8,11-19H2,(H,24,26) |
| InChIKey | FPHPYVPAAHLCRB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |