C12H14ClN3O — CID 131926470
1-[5-(3-chlorophenyl)-1,2,4-triazol-1-yl]butan-2-ol (PubChem CID 131926470) has the molecular formula C12H14ClN3O and a molecular weight of 251.72 g/mol. Its IUPAC name is 1-[5-(3-chlorophenyl)-1,2,4-triazol-1-yl]butan-2-ol.
| Compound Name | 1-[5-(3-chlorophenyl)-1,2,4-triazol-1-yl]butan-2-ol |
|---|---|
| PubChem CID | 131926470 |
| Molecular Formula | C12H14ClN3O |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 1-[5-(3-chlorophenyl)-1,2,4-triazol-1-yl]butan-2-ol |
| SMILES | CCC(O)Cn1ncnc1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H14ClN3O/c1-2-11(17)7-16-12(14-8-15-16)9-4-3-5-10(13)6-9/h3-6,8,11,17H,2,7H2,1H3 |
| InChIKey | OXMFZDVIEYQCQS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |