C18H25N3O3S — CID 131926992
(2S)-2-acetamido-N-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]-4-methylsulfanylbutanamide (PubChem CID 131926992) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is (2S)-2-acetamido-N-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-acetamido-N-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 131926992 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | (2S)-2-acetamido-N-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](NC(C)=O)C(=O)Nc1ccc(N2CCCC2=O)c(C)c1 |
| InChI | InChI=1S/C18H25N3O3S/c1-12-11-14(6-7-16(12)21-9-4-5-17(21)23)20-18(24)15(8-10-25-3)19-13(2)22/h6-7,11,15H,4-5,8-10H2,1-3H3,(H,19,22)(H,20,24)/t15-/m0/s1 |
| InChIKey | HDTHZTRSFLDLKG-HNNXBMFYSA-N |
| XLogP | 2.32 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |