C17H17NO — CID 13192730
2-(16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaen-1-yl)ethanol (PubChem CID 13192730) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-(16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaen-1-yl)ethanol.
| Compound Name | 2-(16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaen-1-yl)ethanol |
|---|---|
| PubChem CID | 13192730 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-(16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaen-1-yl)ethanol |
| SMILES | OCCC12NC(Cc3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C17H17NO/c19-10-9-17-14-7-3-1-5-12(14)11-16(18-17)13-6-2-4-8-15(13)17/h1-8,16,18-19H,9-11H2 |
| InChIKey | RMUFJRNMXTXAFQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |