C25H46O3 — CID 13192747
(12E,15E)-1,1-diethoxyhenicosa-12,15-dien-3-one (PubChem CID 13192747) has the molecular formula C25H46O3 and a molecular weight of 394.64 g/mol. Its IUPAC name is (12E,15E)-1,1-diethoxyhenicosa-12,15-dien-3-one.
| Compound Name | (12E,15E)-1,1-diethoxyhenicosa-12,15-dien-3-one |
|---|---|
| PubChem CID | 13192747 |
| Molecular Formula | C25H46O3 |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 394.34 |
| IUPAC Name | (12E,15E)-1,1-diethoxyhenicosa-12,15-dien-3-one |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCCC(=O)CC(OCC)OCC |
| InChI | InChI=1S/C25H46O3/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24(26)23-25(27-5-2)28-6-3/h10-11,13-14,25H,4-9,12,15-23H2,1-3H3/b11-10+,14-13+ |
| InChIKey | FZEQGYRTHNNATL-IWCZYTNJSA-N |
| XLogP | 7.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|