About N-[2-methoxy-5-(1,2,4-triazol-4-yl)phenyl]-2-piperidin-4-ylacetamide
N-[2-methoxy-5-(1,2,4-triazol-4-yl)phenyl]-2-piperidin-4-ylacetamide (PubChem CID 131927636) has the molecular formula C16H21N5O2
and a molecular weight of 315.38 g/mol. Its IUPAC name is N-[2-methoxy-5-(1,2,4-triazol-4-yl)phenyl]-2-piperidin-4-ylacetamide.
Molecular Properties
| Compound Name | N-[2-methoxy-5-(1,2,4-triazol-4-yl)phenyl]-2-piperidin-4-ylacetamide |
| PubChem CID | 131927636 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | N-[2-methoxy-5-(1,2,4-triazol-4-yl)phenyl]-2-piperidin-4-ylacetamide |
| SMILES | COc1ccc(-n2cnnc2)cc1NC(=O)CC1CCNCC1 |
| InChI | InChI=1S/C16H21N5O2/c1-23-15-3-2-13(21-10-18-19-11-21)9-14(15)20-16(22)8-12-4-6-17-7-5-12/h2-3,9-12,17H,4-8H2,1H3,(H,20,22) |
| InChIKey | AJRHYKPGWYPDFH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-methoxy-5-(1,2,4-triazol-4-yl)phenyl]-2-piperidin-4-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-methoxy-5-(1,2,4-triazol-4-yl)phenyl]-2-piperidin-4-ylacetamide?
The IUPAC name of N-[2-methoxy-5-(1,2,4-triazol-4-yl)phenyl]-2-piperidin-4-ylacetamide (CID 131927636) is N-[2-methoxy-5-(1,2,4-triazol-4-yl)phenyl]-2-piperidin-4-ylacetamide.
What is the SMILES notation for N-[2-methoxy-5-(1,2,4-triazol-4-yl)phenyl]-2-piperidin-4-ylacetamide?
The canonical SMILES for N-[2-methoxy-5-(1,2,4-triazol-4-yl)phenyl]-2-piperidin-4-ylacetamide is COc1ccc(-n2cnnc2)cc1NC(=O)CC1CCNCC1.
What is the InChIKey of N-[2-methoxy-5-(1,2,4-triazol-4-yl)phenyl]-2-piperidin-4-ylacetamide?
The InChIKey is AJRHYKPGWYPDFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N5O2/c1-23-15-3-2-13(21-10-18-19-11-21)9-14(15)20-16(22)8-12-4-6-17-7-5-12/h2-3,9-12,17H,4-8H2,1H3,(H,20,22).
What are the key properties of N-[2-methoxy-5-(1,2,4-triazol-4-yl)phenyl]-2-piperidin-4-ylacetamide?
N-[2-methoxy-5-(1,2,4-triazol-4-yl)phenyl]-2-piperidin-4-ylacetamide has a molecular weight of 315.38 g/mol, XLogP of 1.60, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-methoxy-5-(1,2,4-triazol-4-yl)phenyl]-2-piperidin-4-ylacetamide is sourced from PubChem (CID 131927636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).