C19H22N4O3 — CID 131927818
N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 131927818) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 131927818 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | CCn1cc(C(=O)N[C@@H]2CC=CC[C@H]2C(N)=O)c(=O)c2ccc(C)nc21 |
| InChI | InChI=1S/C19H22N4O3/c1-3-23-10-14(16(24)13-9-8-11(2)21-18(13)23)19(26)22-15-7-5-4-6-12(15)17(20)25/h4-5,8-10,12,15H,3,6-7H2,1-2H3,(H2,20,25)(H,22,26)/t12-,15-/m1/s1 |
| InChIKey | VTOJMQVEYCWKQF-IUODEOHRSA-N |
| XLogP | 1.27 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|