About 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2-(4-methyl-1,4-diazepan-1-yl)ethanone
1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2-(4-methyl-1,4-diazepan-1-yl)ethanone (PubChem CID 131929242) has the molecular formula C12H22FN3O2
and a molecular weight of 259.32 g/mol. Its IUPAC name is 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2-(4-methyl-1,4-diazepan-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2-(4-methyl-1,4-diazepan-1-yl)ethanone |
| PubChem CID | 131929242 |
| Molecular Formula | C12H22FN3O2 |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2-(4-methyl-1,4-diazepan-1-yl)ethanone |
| SMILES | CN1CCCN(CC(=O)N2C[C@@H](O)[C@H](F)C2)CC1 |
| InChI | InChI=1S/C12H22FN3O2/c1-14-3-2-4-15(6-5-14)9-12(18)16-7-10(13)11(17)8-16/h10-11,17H,2-9H2,1H3/t10-,11-/m1/s1 |
| InChIKey | YKKSZXHHFOAYSA-GHMZBOCLSA-N |
| XLogP | -0.83 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2-(4-methyl-1,4-diazepan-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2-(4-methyl-1,4-diazepan-1-yl)ethanone?
The IUPAC name of 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2-(4-methyl-1,4-diazepan-1-yl)ethanone (CID 131929242) is 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2-(4-methyl-1,4-diazepan-1-yl)ethanone.
What is the SMILES notation for 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2-(4-methyl-1,4-diazepan-1-yl)ethanone?
The canonical SMILES for 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2-(4-methyl-1,4-diazepan-1-yl)ethanone is CN1CCCN(CC(=O)N2C[C@@H](O)[C@H](F)C2)CC1.
What is the InChIKey of 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2-(4-methyl-1,4-diazepan-1-yl)ethanone?
The InChIKey is YKKSZXHHFOAYSA-GHMZBOCLSA-N. The full InChI is InChI=1S/C12H22FN3O2/c1-14-3-2-4-15(6-5-14)9-12(18)16-7-10(13)11(17)8-16/h10-11,17H,2-9H2,1H3/t10-,11-/m1/s1.
What are the key properties of 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2-(4-methyl-1,4-diazepan-1-yl)ethanone?
1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2-(4-methyl-1,4-diazepan-1-yl)ethanone has a molecular weight of 259.32 g/mol, XLogP of -0.83, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2-(4-methyl-1,4-diazepan-1-yl)ethanone is sourced from PubChem (CID 131929242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).