About 1-ethyl-9H-pyrido[3,4-b]indole-3-carboxylic acid
1-ethyl-9H-pyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 13192929) has the molecular formula C14H12N2O2
and a molecular weight of 240.26 g/mol. Its IUPAC name is 1-ethyl-9H-pyrido[3,4-b]indole-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-ethyl-9H-pyrido[3,4-b]indole-3-carboxylic acid |
| PubChem CID | 13192929 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 1-ethyl-9H-pyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | CCc1nc(C(=O)O)cc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C14H12N2O2/c1-2-10-13-9(7-12(15-10)14(17)18)8-5-3-4-6-11(8)16-13/h3-7,16H,2H2,1H3,(H,17,18) |
| InChIKey | DAPZVPLVUVKDIF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethyl-9H-pyrido[3,4-b]indole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-9H-pyrido[3,4-b]indole-3-carboxylic acid?
The IUPAC name of 1-ethyl-9H-pyrido[3,4-b]indole-3-carboxylic acid (CID 13192929) is 1-ethyl-9H-pyrido[3,4-b]indole-3-carboxylic acid.
What is the SMILES notation for 1-ethyl-9H-pyrido[3,4-b]indole-3-carboxylic acid?
The canonical SMILES for 1-ethyl-9H-pyrido[3,4-b]indole-3-carboxylic acid is CCc1nc(C(=O)O)cc2c1[nH]c1ccccc12.
What is the InChIKey of 1-ethyl-9H-pyrido[3,4-b]indole-3-carboxylic acid?
The InChIKey is DAPZVPLVUVKDIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O2/c1-2-10-13-9(7-12(15-10)14(17)18)8-5-3-4-6-11(8)16-13/h3-7,16H,2H2,1H3,(H,17,18).
What are the key properties of 1-ethyl-9H-pyrido[3,4-b]indole-3-carboxylic acid?
1-ethyl-9H-pyrido[3,4-b]indole-3-carboxylic acid has a molecular weight of 240.26 g/mol, XLogP of 2.98, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-9H-pyrido[3,4-b]indole-3-carboxylic acid is sourced from PubChem (CID 13192929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).