C22H23ClN4O2 — CID 131930977
[2-(6-chloro-1H-benzimidazol-2-yl)pyrrolidin-1-yl]-(2-morpholin-4-ylphenyl)methanone (PubChem CID 131930977) has the molecular formula C22H23ClN4O2 and a molecular weight of 410.91 g/mol. Its IUPAC name is [2-(6-chloro-1H-benzimidazol-2-yl)pyrrolidin-1-yl]-(2-morpholin-4-ylphenyl)methanone.
| Compound Name | [2-(6-chloro-1H-benzimidazol-2-yl)pyrrolidin-1-yl]-(2-morpholin-4-ylphenyl)methanone |
|---|---|
| PubChem CID | 131930977 |
| Molecular Formula | C22H23ClN4O2 |
| Molecular Weight | 410.91 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | [2-(6-chloro-1H-benzimidazol-2-yl)pyrrolidin-1-yl]-(2-morpholin-4-ylphenyl)methanone |
| SMILES | O=C(c1ccccc1N1CCOCC1)N1CCCC1c1nc2ccc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C22H23ClN4O2/c23-15-7-8-17-18(14-15)25-21(24-17)20-6-3-9-27(20)22(28)16-4-1-2-5-19(16)26-10-12-29-13-11-26/h1-2,4-5,7-8,14,20H,3,6,9-13H2,(H,24,25) |
| InChIKey | HVQBQYZWLYGEAR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.91 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |