C15H16ClFN2O2 — CID 131934064
N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-2-chloro-6-fluoro-3-methylbenzamide (PubChem CID 131934064) has the molecular formula C15H16ClFN2O2 and a molecular weight of 310.76 g/mol. Its IUPAC name is N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-2-chloro-6-fluoro-3-methylbenzamide.
| Compound Name | N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-2-chloro-6-fluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 131934064 |
| Molecular Formula | C15H16ClFN2O2 |
| Molecular Weight | 310.76 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-2-chloro-6-fluoro-3-methylbenzamide |
| SMILES | Cc1ccc(F)c(C(=O)N[C@@H]2CC=CC[C@H]2C(N)=O)c1Cl |
| InChI | InChI=1S/C15H16ClFN2O2/c1-8-6-7-10(17)12(13(8)16)15(21)19-11-5-3-2-4-9(11)14(18)20/h2-3,6-7,9,11H,4-5H2,1H3,(H2,18,20)(H,19,21)/t9-,11-/m1/s1 |
| InChIKey | YOWNGVDZDJCRNU-MWLCHTKSSA-N |
| XLogP | 2.34 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.76 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|