C22H24ClN5O — CID 131934591
3-chloro-N-[1-(3-cyano-2-pyridinyl)piperidin-4-yl]-4-pyrrolidin-1-ylbenzamide (PubChem CID 131934591) has the molecular formula C22H24ClN5O and a molecular weight of 409.92 g/mol. Its IUPAC name is 3-chloro-N-[1-(3-cyano-2-pyridinyl)piperidin-4-yl]-4-pyrrolidin-1-ylbenzamide.
| Compound Name | 3-chloro-N-[1-(3-cyano-2-pyridinyl)piperidin-4-yl]-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 131934591 |
| Molecular Formula | C22H24ClN5O |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 3-chloro-N-[1-(3-cyano-2-pyridinyl)piperidin-4-yl]-4-pyrrolidin-1-ylbenzamide |
| SMILES | N#Cc1cccnc1N1CCC(NC(=O)c2ccc(N3CCCC3)c(Cl)c2)CC1 |
| InChI | InChI=1S/C22H24ClN5O/c23-19-14-16(5-6-20(19)27-10-1-2-11-27)22(29)26-18-7-12-28(13-8-18)21-17(15-24)4-3-9-25-21/h3-6,9,14,18H,1-2,7-8,10-13H2,(H,26,29) |
| InChIKey | FITPEGCAQKDBLD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |