C28H30N8O3S — CID 131935059
(7S,11S)-17-methyl-9-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1,4,5,6,9,14,17-heptazatetracyclo[17.3.1.13,6.07,11]tetracosa-3(24),4,19,21-tetraene-13,18,23-trione (PubChem CID 131935059) has the molecular formula C28H30N8O3S and a molecular weight of 558.67 g/mol. Its IUPAC name is (7S,11S)-17-methyl-9-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1,4,5,6,9,14,17-heptazatetracyclo[17.3.1.13,6.07,11]tetracosa-3(24),4,19,21-tetraene-13,18,23-trione.
| Compound Name | (7S,11S)-17-methyl-9-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1,4,5,6,9,14,17-heptazatetracyclo[17.3.1.13,6.07,11]tetracosa-3(24),4,19,21-tetraene-13,18,23-trione |
|---|---|
| PubChem CID | 131935059 |
| Molecular Formula | C28H30N8O3S |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | (7S,11S)-17-methyl-9-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1,4,5,6,9,14,17-heptazatetracyclo[17.3.1.13,6.07,11]tetracosa-3(24),4,19,21-tetraene-13,18,23-trione |
| SMILES | CN1CCNC(=O)C[C@H]2CN(Cc3nc(-c4ccccc4)cs3)C[C@H]2n2cc(nn2)Cn2cccc(c2=O)C1=O |
| InChI | InChI=1S/C28H30N8O3S/c1-33-11-9-29-25(37)12-20-13-34(17-26-30-23(18-40-26)19-6-3-2-4-7-19)16-24(20)36-15-21(31-32-36)14-35-10-5-8-22(27(33)38)28(35)39/h2-8,10,15,18,20,24H,9,11-14,16-17H2,1H3,(H,29,37)/t20-,24+/m0/s1 |
| InChIKey | WCRRTGCXRUAVTL-GBXCKJPGSA-N |
| XLogP | 1.88 |
| TPSA | 118.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |