About N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-3-(4-methoxyphenyl)benzamide
N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-3-(4-methoxyphenyl)benzamide (PubChem CID 131935116) has the molecular formula C21H22N2O3
and a molecular weight of 350.42 g/mol. Its IUPAC name is N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-3-(4-methoxyphenyl)benzamide.
Molecular Properties
| Compound Name | N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-3-(4-methoxyphenyl)benzamide |
| PubChem CID | 131935116 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-3-(4-methoxyphenyl)benzamide |
| SMILES | COc1ccc(-c2cccc(C(=O)N[C@@H]3CC=CC[C@H]3C(N)=O)c2)cc1 |
| InChI | InChI=1S/C21H22N2O3/c1-26-17-11-9-14(10-12-17)15-5-4-6-16(13-15)21(25)23-19-8-3-2-7-18(19)20(22)24/h2-6,9-13,18-19H,7-8H2,1H3,(H2,22,24)(H,23,25)/t18-,19-/m1/s1 |
| InChIKey | BQNOJDSMHTZYBU-RTBURBONSA-N |
| XLogP | 2.91 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-3-(4-methoxyphenyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-3-(4-methoxyphenyl)benzamide?
The IUPAC name of N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-3-(4-methoxyphenyl)benzamide (CID 131935116) is N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-3-(4-methoxyphenyl)benzamide.
What is the SMILES notation for N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-3-(4-methoxyphenyl)benzamide?
The canonical SMILES for N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-3-(4-methoxyphenyl)benzamide is COc1ccc(-c2cccc(C(=O)N[C@@H]3CC=CC[C@H]3C(N)=O)c2)cc1.
What is the InChIKey of N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-3-(4-methoxyphenyl)benzamide?
The InChIKey is BQNOJDSMHTZYBU-RTBURBONSA-N. The full InChI is InChI=1S/C21H22N2O3/c1-26-17-11-9-14(10-12-17)15-5-4-6-16(13-15)21(25)23-19-8-3-2-7-18(19)20(22)24/h2-6,9-13,18-19H,7-8H2,1H3,(H2,22,24)(H,23,25)/t18-,19-/m1/s1.
What are the key properties of N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-3-(4-methoxyphenyl)benzamide?
N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-3-(4-methoxyphenyl)benzamide has a molecular weight of 350.42 g/mol, XLogP of 2.91, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-3-(4-methoxyphenyl)benzamide is sourced from PubChem (CID 131935116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).