C32H40F2N6O7 — CID 131935706
(3R,6S,9S,12R)-3-benzyl-16-[2-(2,4-difluorophenyl)acetyl]-6-(hydroxymethyl)-9-methyl-12-propan-2-yl-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14-pentone (PubChem CID 131935706) has the molecular formula C32H40F2N6O7 and a molecular weight of 658.70 g/mol. Its IUPAC name is (3R,6S,9S,12R)-3-benzyl-16-[2-(2,4-difluorophenyl)acetyl]-6-(hydroxymethyl)-9-methyl-12-propan-2-yl-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14-pentone.
| Compound Name | (3R,6S,9S,12R)-3-benzyl-16-[2-(2,4-difluorophenyl)acetyl]-6-(hydroxymethyl)-9-methyl-12-propan-2-yl-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14-pentone |
|---|---|
| PubChem CID | 131935706 |
| Molecular Formula | C32H40F2N6O7 |
| Molecular Weight | 658.70 g/mol |
| Exact Mass | 658.29 |
| IUPAC Name | (3R,6S,9S,12R)-3-benzyl-16-[2-(2,4-difluorophenyl)acetyl]-6-(hydroxymethyl)-9-methyl-12-propan-2-yl-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14-pentone |
| SMILES | CC(C)[C@H]1NC(=O)CN(C(=O)Cc2ccc(F)cc2F)CCNC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](CO)NC(=O)[C@H](C)NC1=O |
| InChI | InChI=1S/C32H40F2N6O7/c1-18(2)28-32(47)36-19(3)29(44)38-25(17-41)31(46)37-24(13-20-7-5-4-6-8-20)30(45)35-11-12-40(16-26(42)39-28)27(43)14-21-9-10-22(33)15-23(21)34/h4-10,15,18-19,24-25,28,41H,11-14,16-17H2,1-3H3,(H,35,45)(H,36,47)(H,37,46)(H,38,44)(H,39,42)/t19-,24+,25-,28+/m0/s1 |
| InChIKey | RXQGNTQERGHNRQ-GMFLGUOUSA-N |
| XLogP | -0.68 |
| TPSA | 186.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.70 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |