C22H30FN3O2 — CID 131935945
1-ethyl-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-3-(2-methylpropyl)pyrazole-5-carboxamide (PubChem CID 131935945) has the molecular formula C22H30FN3O2 and a molecular weight of 387.50 g/mol. Its IUPAC name is 1-ethyl-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-3-(2-methylpropyl)pyrazole-5-carboxamide.
| Compound Name | 1-ethyl-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-3-(2-methylpropyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 131935945 |
| Molecular Formula | C22H30FN3O2 |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 1-ethyl-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-3-(2-methylpropyl)pyrazole-5-carboxamide |
| SMILES | CCn1nc(CC(C)C)cc1C(=O)NCC1(c2cccc(F)c2)CCOCC1 |
| InChI | InChI=1S/C22H30FN3O2/c1-4-26-20(14-19(25-26)12-16(2)3)21(27)24-15-22(8-10-28-11-9-22)17-6-5-7-18(23)13-17/h5-7,13-14,16H,4,8-12,15H2,1-3H3,(H,24,27) |
| InChIKey | YBDYWGOKGOGTEF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |