C16H22F2N2O3 — CID 131936846
[1-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methylamino]ethyl]piperidin-2-yl]methanol (PubChem CID 131936846) has the molecular formula C16H22F2N2O3 and a molecular weight of 328.36 g/mol. Its IUPAC name is [1-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methylamino]ethyl]piperidin-2-yl]methanol.
| Compound Name | [1-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methylamino]ethyl]piperidin-2-yl]methanol |
|---|---|
| PubChem CID | 131936846 |
| Molecular Formula | C16H22F2N2O3 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | [1-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)methylamino]ethyl]piperidin-2-yl]methanol |
| SMILES | OCC1CCCCN1CCNCc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C16H22F2N2O3/c17-16(18)22-14-5-4-12(9-15(14)23-16)10-19-6-8-20-7-2-1-3-13(20)11-21/h4-5,9,13,19,21H,1-3,6-8,10-11H2 |
| InChIKey | WIPLGAYXSMULAU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|