C13H17FN4O2S — CID 131936854
3-(2-butyl-5-methyl-1,2,4-triazol-3-yl)-4-fluorobenzenesulfonamide (PubChem CID 131936854) has the molecular formula C13H17FN4O2S and a molecular weight of 312.37 g/mol. Its IUPAC name is 3-(2-butyl-5-methyl-1,2,4-triazol-3-yl)-4-fluorobenzenesulfonamide.
| Compound Name | 3-(2-butyl-5-methyl-1,2,4-triazol-3-yl)-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 131936854 |
| Molecular Formula | C13H17FN4O2S |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 3-(2-butyl-5-methyl-1,2,4-triazol-3-yl)-4-fluorobenzenesulfonamide |
| SMILES | CCCCn1nc(C)nc1-c1cc(S(N)(=O)=O)ccc1F |
| InChI | InChI=1S/C13H17FN4O2S/c1-3-4-7-18-13(16-9(2)17-18)11-8-10(21(15,19)20)5-6-12(11)14/h5-6,8H,3-4,7H2,1-2H3,(H2,15,19,20) |
| InChIKey | KCMBKVDHZBWDEV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |