C22H32N2O3 — CID 131938008
cis-(1R,2S)-1-N-butyl-2-N-[2-(2-methylprop-2-enoxy)phenyl]cyclohexane-1,2-dicarboxamide (PubChem CID 131938008) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is cis-(1R,2S)-1-N-butyl-2-N-[2-(2-methylprop-2-enoxy)phenyl]cyclohexane-1,2-dicarboxamide.
| Compound Name | cis-(1R,2S)-1-N-butyl-2-N-[2-(2-methylprop-2-enoxy)phenyl]cyclohexane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 131938008 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | cis-(1R,2S)-1-N-butyl-2-N-[2-(2-methylprop-2-enoxy)phenyl]cyclohexane-1,2-dicarboxamide |
| SMILES | C=C(C)COc1ccccc1NC(=O)[C@H]1CCCC[C@H]1C(=O)NCCCC |
| InChI | InChI=1S/C22H32N2O3/c1-4-5-14-23-21(25)17-10-6-7-11-18(17)22(26)24-19-12-8-9-13-20(19)27-15-16(2)3/h8-9,12-13,17-18H,2,4-7,10-11,14-15H2,1,3H3,(H,23,25)(H,24,26)/t17-,18+/m1/s1 |
| InChIKey | KQYAPOGGKDMSGE-MSOLQXFVSA-N |
| XLogP | 4.30 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|