About 3-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-(thiophen-3-ylmethyl)propanamide
3-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-(thiophen-3-ylmethyl)propanamide (PubChem CID 131938710) has the molecular formula C11H13N3O3S
and a molecular weight of 267.31 g/mol. Its IUPAC name is 3-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-(thiophen-3-ylmethyl)propanamide.
Molecular Properties
| Compound Name | 3-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-(thiophen-3-ylmethyl)propanamide |
| PubChem CID | 131938710 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 3-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-(thiophen-3-ylmethyl)propanamide |
| SMILES | O=C(CC[C@@H]1NC(=O)NC1=O)NCc1ccsc1 |
| InChI | InChI=1S/C11H13N3O3S/c15-9(12-5-7-3-4-18-6-7)2-1-8-10(16)14-11(17)13-8/h3-4,6,8H,1-2,5H2,(H,12,15)(H2,13,14,16,17)/t8-/m0/s1 |
| InChIKey | KUGXDBHIUHLINJ-QMMMGPOBSA-N |
| XLogP | 0.35 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-(thiophen-3-ylmethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-(thiophen-3-ylmethyl)propanamide?
The IUPAC name of 3-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-(thiophen-3-ylmethyl)propanamide (CID 131938710) is 3-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-(thiophen-3-ylmethyl)propanamide.
What is the SMILES notation for 3-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-(thiophen-3-ylmethyl)propanamide?
The canonical SMILES for 3-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-(thiophen-3-ylmethyl)propanamide is O=C(CC[C@@H]1NC(=O)NC1=O)NCc1ccsc1.
What is the InChIKey of 3-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-(thiophen-3-ylmethyl)propanamide?
The InChIKey is KUGXDBHIUHLINJ-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H13N3O3S/c15-9(12-5-7-3-4-18-6-7)2-1-8-10(16)14-11(17)13-8/h3-4,6,8H,1-2,5H2,(H,12,15)(H2,13,14,16,17)/t8-/m0/s1.
What are the key properties of 3-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-(thiophen-3-ylmethyl)propanamide?
3-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-(thiophen-3-ylmethyl)propanamide has a molecular weight of 267.31 g/mol, XLogP of 0.35, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-(thiophen-3-ylmethyl)propanamide is sourced from PubChem (CID 131938710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).