C21H18N4O4 — CID 131938944
1-methyl-N-[2-(4-methyl-2,5-dioxoimidazolidin-1-yl)phenyl]-2-oxoquinoline-3-carboxamide (PubChem CID 131938944) has the molecular formula C21H18N4O4 and a molecular weight of 390.40 g/mol. Its IUPAC name is 1-methyl-N-[2-(4-methyl-2,5-dioxoimidazolidin-1-yl)phenyl]-2-oxoquinoline-3-carboxamide.
| Compound Name | 1-methyl-N-[2-(4-methyl-2,5-dioxoimidazolidin-1-yl)phenyl]-2-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 131938944 |
| Molecular Formula | C21H18N4O4 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 1-methyl-N-[2-(4-methyl-2,5-dioxoimidazolidin-1-yl)phenyl]-2-oxoquinoline-3-carboxamide |
| SMILES | CC1NC(=O)N(c2ccccc2NC(=O)c2cc3ccccc3n(C)c2=O)C1=O |
| InChI | InChI=1S/C21H18N4O4/c1-12-19(27)25(21(29)22-12)17-10-6-4-8-15(17)23-18(26)14-11-13-7-3-5-9-16(13)24(2)20(14)28/h3-12H,1-2H3,(H,22,29)(H,23,26) |
| InChIKey | BKIGGGUYQUVQMO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|