C29H35FN6O3 — CID 131939050
(7S)-7-benzyl-1'-[(2-fluoro-4-methoxyphenyl)methyl]spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione (PubChem CID 131939050) has the molecular formula C29H35FN6O3 and a molecular weight of 534.64 g/mol. Its IUPAC name is (7S)-7-benzyl-1'-[(2-fluoro-4-methoxyphenyl)methyl]spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione.
| Compound Name | (7S)-7-benzyl-1'-[(2-fluoro-4-methoxyphenyl)methyl]spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione |
|---|---|
| PubChem CID | 131939050 |
| Molecular Formula | C29H35FN6O3 |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | (7S)-7-benzyl-1'-[(2-fluoro-4-methoxyphenyl)methyl]spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione |
| SMILES | COc1ccc(CN2CCC3(CC2)Cc2cn(nn2)CCCNC(=O)[C@H](Cc2ccccc2)NC3=O)c(F)c1 |
| InChI | InChI=1S/C29H35FN6O3/c1-39-24-9-8-22(25(30)17-24)19-35-14-10-29(11-15-35)18-23-20-36(34-33-23)13-5-12-31-27(37)26(32-28(29)38)16-21-6-3-2-4-7-21/h2-4,6-9,17,20,26H,5,10-16,18-19H2,1H3,(H,31,37)(H,32,38)/t26-/m0/s1 |
| InChIKey | LPUOQDWONZFNOI-SANMLTNESA-N |
| XLogP | 2.50 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |