About N-[(3R,4S)-3-methoxyoxan-4-yl]pyridine-3-sulfonamide
N-[(3R,4S)-3-methoxyoxan-4-yl]pyridine-3-sulfonamide (PubChem CID 131940059) has the molecular formula C11H16N2O4S
and a molecular weight of 272.33 g/mol. Its IUPAC name is N-[(3R,4S)-3-methoxyoxan-4-yl]pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | N-[(3R,4S)-3-methoxyoxan-4-yl]pyridine-3-sulfonamide |
| PubChem CID | 131940059 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | N-[(3R,4S)-3-methoxyoxan-4-yl]pyridine-3-sulfonamide |
| SMILES | CO[C@H]1COCC[C@@H]1NS(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C11H16N2O4S/c1-16-11-8-17-6-4-10(11)13-18(14,15)9-3-2-5-12-7-9/h2-3,5,7,10-11,13H,4,6,8H2,1H3/t10-,11-/m0/s1 |
| InChIKey | CDLKGOLJAJEEAE-QWRGUYRKSA-N |
| XLogP | 0.16 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3R,4S)-3-methoxyoxan-4-yl]pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R,4S)-3-methoxyoxan-4-yl]pyridine-3-sulfonamide?
The IUPAC name of N-[(3R,4S)-3-methoxyoxan-4-yl]pyridine-3-sulfonamide (CID 131940059) is N-[(3R,4S)-3-methoxyoxan-4-yl]pyridine-3-sulfonamide.
What is the SMILES notation for N-[(3R,4S)-3-methoxyoxan-4-yl]pyridine-3-sulfonamide?
The canonical SMILES for N-[(3R,4S)-3-methoxyoxan-4-yl]pyridine-3-sulfonamide is CO[C@H]1COCC[C@@H]1NS(=O)(=O)c1cccnc1.
What is the InChIKey of N-[(3R,4S)-3-methoxyoxan-4-yl]pyridine-3-sulfonamide?
The InChIKey is CDLKGOLJAJEEAE-QWRGUYRKSA-N. The full InChI is InChI=1S/C11H16N2O4S/c1-16-11-8-17-6-4-10(11)13-18(14,15)9-3-2-5-12-7-9/h2-3,5,7,10-11,13H,4,6,8H2,1H3/t10-,11-/m0/s1.
What are the key properties of N-[(3R,4S)-3-methoxyoxan-4-yl]pyridine-3-sulfonamide?
N-[(3R,4S)-3-methoxyoxan-4-yl]pyridine-3-sulfonamide has a molecular weight of 272.33 g/mol, XLogP of 0.16, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R,4S)-3-methoxyoxan-4-yl]pyridine-3-sulfonamide is sourced from PubChem (CID 131940059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).