C13H15N3O2S2 — CID 131940296
5-acetyl-N-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]thiophene-2-carboxamide (PubChem CID 131940296) has the molecular formula C13H15N3O2S2 and a molecular weight of 309.42 g/mol. Its IUPAC name is 5-acetyl-N-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]thiophene-2-carboxamide.
| Compound Name | 5-acetyl-N-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 131940296 |
| Molecular Formula | C13H15N3O2S2 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 5-acetyl-N-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]thiophene-2-carboxamide |
| SMILES | CSc1ncc(CNC(=O)c2ccc(C(C)=O)s2)n1C |
| InChI | InChI=1S/C13H15N3O2S2/c1-8(17)10-4-5-11(20-10)12(18)14-6-9-7-15-13(19-3)16(9)2/h4-5,7H,6H2,1-3H3,(H,14,18) |
| InChIKey | BUJCJNAEDPHLSY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |