C26H32N4O5 — CID 131940767
(17R)-5-(2-methylpropoxy)-2-oxa-9,12,15,19-tetrazatetracyclo[20.3.1.13,7.012,17]heptacosa-1(25),3,5,7(27),22(26),23-hexaene-8,11,18-trione (PubChem CID 131940767) has the molecular formula C26H32N4O5 and a molecular weight of 480.57 g/mol. Its IUPAC name is (17R)-5-(2-methylpropoxy)-2-oxa-9,12,15,19-tetrazatetracyclo[20.3.1.13,7.012,17]heptacosa-1(25),3,5,7(27),22(26),23-hexaene-8,11,18-trione.
| Compound Name | (17R)-5-(2-methylpropoxy)-2-oxa-9,12,15,19-tetrazatetracyclo[20.3.1.13,7.012,17]heptacosa-1(25),3,5,7(27),22(26),23-hexaene-8,11,18-trione |
|---|---|
| PubChem CID | 131940767 |
| Molecular Formula | C26H32N4O5 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | (17R)-5-(2-methylpropoxy)-2-oxa-9,12,15,19-tetrazatetracyclo[20.3.1.13,7.012,17]heptacosa-1(25),3,5,7(27),22(26),23-hexaene-8,11,18-trione |
| SMILES | CC(C)COc1cc2cc(c1)C(=O)NCC(=O)N1CCNC[C@@H]1C(=O)NCCc1cccc(c1)O2 |
| InChI | InChI=1S/C26H32N4O5/c1-17(2)16-34-21-11-19-12-22(13-21)35-20-5-3-4-18(10-20)6-7-28-26(33)23-14-27-8-9-30(23)24(31)15-29-25(19)32/h3-5,10-13,17,23,27H,6-9,14-16H2,1-2H3,(H,28,33)(H,29,32)/t23-/m1/s1 |
| InChIKey | PCQODYBTAOESDB-HSZRJFAPSA-N |
| XLogP | 1.72 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |