C14H26N2O2 — CID 131940845
(3aR,5S,6S,7aS)-2-(1-methylpiperidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol (PubChem CID 131940845) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is (3aR,5S,6S,7aS)-2-(1-methylpiperidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol.
| Compound Name | (3aR,5S,6S,7aS)-2-(1-methylpiperidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol |
|---|---|
| PubChem CID | 131940845 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | (3aR,5S,6S,7aS)-2-(1-methylpiperidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol |
| SMILES | CN1CCC(N2C[C@H]3C[C@H](O)[C@@H](O)C[C@H]3C2)CC1 |
| InChI | InChI=1S/C14H26N2O2/c1-15-4-2-12(3-5-15)16-8-10-6-13(17)14(18)7-11(10)9-16/h10-14,17-18H,2-9H2,1H3/t10-,11+,13-,14-/m0/s1 |
| InChIKey | GOJGAKXAPDLXGO-XCCSTKFXSA-N |
| XLogP | 0.14 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |