C16H14BrN — CID 13194161
4-bromo-1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),3,5,10,12,14-hexaene (PubChem CID 13194161) has the molecular formula C16H14BrN and a molecular weight of 300.20 g/mol. Its IUPAC name is 4-bromo-1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),3,5,10,12,14-hexaene.
| Compound Name | 4-bromo-1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),3,5,10,12,14-hexaene |
|---|---|
| PubChem CID | 13194161 |
| Molecular Formula | C16H14BrN |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 4-bromo-1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),3,5,10,12,14-hexaene |
| SMILES | CC12NC(Cc3ccc(Br)cc31)c1ccccc12 |
| InChI | InChI=1S/C16H14BrN/c1-16-13-5-3-2-4-12(13)15(18-16)8-10-6-7-11(17)9-14(10)16/h2-7,9,15,18H,8H2,1H3 |
| InChIKey | JHHJEEKLDDSWTB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |