C16H15NO — CID 13194169
1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),3,5,10,12,14-hexaen-5-ol (PubChem CID 13194169) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is 1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),3,5,10,12,14-hexaen-5-ol.
| Compound Name | 1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),3,5,10,12,14-hexaen-5-ol |
|---|---|
| PubChem CID | 13194169 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),3,5,10,12,14-hexaen-5-ol |
| SMILES | CC12NC(Cc3cc(O)ccc31)c1ccccc12 |
| InChI | InChI=1S/C16H15NO/c1-16-13-7-6-11(18)8-10(13)9-15(17-16)12-4-2-3-5-14(12)16/h2-8,15,17-18H,9H2,1H3 |
| InChIKey | YFQXIMCPJVXWDV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |