C16H14BrNO — CID 13194185
N-(5-bromo-2-methylidene-9-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)hydroxylamine (PubChem CID 13194185) has the molecular formula C16H14BrNO and a molecular weight of 316.20 g/mol. Its IUPAC name is N-(5-bromo-2-methylidene-9-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)hydroxylamine.
| Compound Name | N-(5-bromo-2-methylidene-9-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)hydroxylamine |
|---|---|
| PubChem CID | 13194185 |
| Molecular Formula | C16H14BrNO |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | N-(5-bromo-2-methylidene-9-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)hydroxylamine |
| SMILES | C=C1c2ccccc2CC(NO)c2ccc(Br)cc21 |
| InChI | InChI=1S/C16H14BrNO/c1-10-13-5-3-2-4-11(13)8-16(18-19)14-7-6-12(17)9-15(10)14/h2-7,9,16,18-19H,1,8H2 |
| InChIKey | YJFXBUGSPNQDFY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|