About 1-(1,3-benzodioxol-5-yl)-N-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]piperidin-4-amine
1-(1,3-benzodioxol-5-yl)-N-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]piperidin-4-amine (PubChem CID 131942864) has the molecular formula C18H24N4O2
and a molecular weight of 328.42 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]piperidin-4-amine.
Molecular Properties
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]piperidin-4-amine |
| PubChem CID | 131942864 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]piperidin-4-amine |
| SMILES | Cc1[nH]ncc1CN(C)C1CCN(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C18H24N4O2/c1-13-14(10-19-20-13)11-21(2)15-5-7-22(8-6-15)16-3-4-17-18(9-16)24-12-23-17/h3-4,9-10,15H,5-8,11-12H2,1-2H3,(H,19,20) |
| InChIKey | FHKOOVHHKYPXSW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 53.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,3-benzodioxol-5-yl)-N-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-benzodioxol-5-yl)-N-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]piperidin-4-amine?
The IUPAC name of 1-(1,3-benzodioxol-5-yl)-N-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]piperidin-4-amine (CID 131942864) is 1-(1,3-benzodioxol-5-yl)-N-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]piperidin-4-amine.
What is the SMILES notation for 1-(1,3-benzodioxol-5-yl)-N-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]piperidin-4-amine?
The canonical SMILES for 1-(1,3-benzodioxol-5-yl)-N-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]piperidin-4-amine is Cc1[nH]ncc1CN(C)C1CCN(c2ccc3c(c2)OCO3)CC1.
What is the InChIKey of 1-(1,3-benzodioxol-5-yl)-N-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]piperidin-4-amine?
The InChIKey is FHKOOVHHKYPXSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N4O2/c1-13-14(10-19-20-13)11-21(2)15-5-7-22(8-6-15)16-3-4-17-18(9-16)24-12-23-17/h3-4,9-10,15H,5-8,11-12H2,1-2H3,(H,19,20).
What are the key properties of 1-(1,3-benzodioxol-5-yl)-N-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]piperidin-4-amine?
1-(1,3-benzodioxol-5-yl)-N-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]piperidin-4-amine has a molecular weight of 328.42 g/mol, XLogP of 2.55, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-benzodioxol-5-yl)-N-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]piperidin-4-amine is sourced from PubChem (CID 131942864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).