About N-[(4-ethyl-1,3-thiazol-2-yl)methyl]morpholine-4-sulfonamide
N-[(4-ethyl-1,3-thiazol-2-yl)methyl]morpholine-4-sulfonamide (PubChem CID 131942873) has the molecular formula C10H17N3O3S2
and a molecular weight of 291.40 g/mol. Its IUPAC name is N-[(4-ethyl-1,3-thiazol-2-yl)methyl]morpholine-4-sulfonamide.
Molecular Properties
| Compound Name | N-[(4-ethyl-1,3-thiazol-2-yl)methyl]morpholine-4-sulfonamide |
| PubChem CID | 131942873 |
| Molecular Formula | C10H17N3O3S2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | N-[(4-ethyl-1,3-thiazol-2-yl)methyl]morpholine-4-sulfonamide |
| SMILES | CCc1csc(CNS(=O)(=O)N2CCOCC2)n1 |
| InChI | InChI=1S/C10H17N3O3S2/c1-2-9-8-17-10(12-9)7-11-18(14,15)13-3-5-16-6-4-13/h8,11H,2-7H2,1H3 |
| InChIKey | GLKZVSHRXRRJPM-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(4-ethyl-1,3-thiazol-2-yl)methyl]morpholine-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-ethyl-1,3-thiazol-2-yl)methyl]morpholine-4-sulfonamide?
The IUPAC name of N-[(4-ethyl-1,3-thiazol-2-yl)methyl]morpholine-4-sulfonamide (CID 131942873) is N-[(4-ethyl-1,3-thiazol-2-yl)methyl]morpholine-4-sulfonamide.
What is the SMILES notation for N-[(4-ethyl-1,3-thiazol-2-yl)methyl]morpholine-4-sulfonamide?
The canonical SMILES for N-[(4-ethyl-1,3-thiazol-2-yl)methyl]morpholine-4-sulfonamide is CCc1csc(CNS(=O)(=O)N2CCOCC2)n1.
What is the InChIKey of N-[(4-ethyl-1,3-thiazol-2-yl)methyl]morpholine-4-sulfonamide?
The InChIKey is GLKZVSHRXRRJPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O3S2/c1-2-9-8-17-10(12-9)7-11-18(14,15)13-3-5-16-6-4-13/h8,11H,2-7H2,1H3.
What are the key properties of N-[(4-ethyl-1,3-thiazol-2-yl)methyl]morpholine-4-sulfonamide?
N-[(4-ethyl-1,3-thiazol-2-yl)methyl]morpholine-4-sulfonamide has a molecular weight of 291.40 g/mol, XLogP of 0.37, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-ethyl-1,3-thiazol-2-yl)methyl]morpholine-4-sulfonamide is sourced from PubChem (CID 131942873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).