C29H33FN6O4 — CID 131944433
(7S)-7-benzyl-1'-(4-fluoro-3-methoxybenzoyl)spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione (PubChem CID 131944433) has the molecular formula C29H33FN6O4 and a molecular weight of 548.62 g/mol. Its IUPAC name is (7S)-7-benzyl-1'-(4-fluoro-3-methoxybenzoyl)spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione.
| Compound Name | (7S)-7-benzyl-1'-(4-fluoro-3-methoxybenzoyl)spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione |
|---|---|
| PubChem CID | 131944433 |
| Molecular Formula | C29H33FN6O4 |
| Molecular Weight | 548.62 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | (7S)-7-benzyl-1'-(4-fluoro-3-methoxybenzoyl)spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione |
| SMILES | COc1cc(C(=O)N2CCC3(CC2)Cc2cn(nn2)CCCNC(=O)[C@H](Cc2ccccc2)NC3=O)ccc1F |
| InChI | InChI=1S/C29H33FN6O4/c1-40-25-17-21(8-9-23(25)30)27(38)35-14-10-29(11-15-35)18-22-19-36(34-33-22)13-5-12-31-26(37)24(32-28(29)39)16-20-6-3-2-4-7-20/h2-4,6-9,17,19,24H,5,10-16,18H2,1H3,(H,31,37)(H,32,39)/t24-/m0/s1 |
| InChIKey | GNSPZGIXKZNSLD-DEOSSOPVSA-N |
| XLogP | 2.14 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.62 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |