C17H17N5O2S — CID 131945997
2-[2-(2,1,3-benzoxadiazol-4-ylmethylamino)ethyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 131945997) has the molecular formula C17H17N5O2S and a molecular weight of 355.42 g/mol. Its IUPAC name is 2-[2-(2,1,3-benzoxadiazol-4-ylmethylamino)ethyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[2-(2,1,3-benzoxadiazol-4-ylmethylamino)ethyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 131945997 |
| Molecular Formula | C17H17N5O2S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2-[2-(2,1,3-benzoxadiazol-4-ylmethylamino)ethyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2nc(CCNCc3cccc4nonc34)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C17H17N5O2S/c1-9-10(2)25-17-14(9)16(23)19-13(20-17)6-7-18-8-11-4-3-5-12-15(11)22-24-21-12/h3-5,18H,6-8H2,1-2H3,(H,19,20,23) |
| InChIKey | FWVUPUNFDHDLKP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|