C16H21N3S2 — CID 131946378
N-(1-phenyl-2-pyrazol-1-ylethyl)-1,4-dithiepan-6-amine (PubChem CID 131946378) has the molecular formula C16H21N3S2 and a molecular weight of 319.50 g/mol. Its IUPAC name is N-(1-phenyl-2-pyrazol-1-ylethyl)-1,4-dithiepan-6-amine.
| Compound Name | N-(1-phenyl-2-pyrazol-1-ylethyl)-1,4-dithiepan-6-amine |
|---|---|
| PubChem CID | 131946378 |
| Molecular Formula | C16H21N3S2 |
| Molecular Weight | 319.50 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-(1-phenyl-2-pyrazol-1-ylethyl)-1,4-dithiepan-6-amine |
| SMILES | c1ccc(C(Cn2cccn2)NC2CSCCSC2)cc1 |
| InChI | InChI=1S/C16H21N3S2/c1-2-5-14(6-3-1)16(11-19-8-4-7-17-19)18-15-12-20-9-10-21-13-15/h1-8,15-16,18H,9-13H2 |
| InChIKey | RRKUDYIBNWTNBT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |