C16H24N2O4 — CID 131947258
N-(2-hydroxy-3-methoxypropyl)-N-methyl-3-(2-methylpropanoylamino)benzamide (PubChem CID 131947258) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is N-(2-hydroxy-3-methoxypropyl)-N-methyl-3-(2-methylpropanoylamino)benzamide.
| Compound Name | N-(2-hydroxy-3-methoxypropyl)-N-methyl-3-(2-methylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 131947258 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | N-(2-hydroxy-3-methoxypropyl)-N-methyl-3-(2-methylpropanoylamino)benzamide |
| SMILES | COCC(O)CN(C)C(=O)c1cccc(NC(=O)C(C)C)c1 |
| InChI | InChI=1S/C16H24N2O4/c1-11(2)15(20)17-13-7-5-6-12(8-13)16(21)18(3)9-14(19)10-22-4/h5-8,11,14,19H,9-10H2,1-4H3,(H,17,20) |
| InChIKey | JOGPSPHFGCOOHF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |