C21H22N4O — CID 131947501
N-(1,2-diethylbenzimidazol-5-yl)-1-methylindole-6-carboxamide (PubChem CID 131947501) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is N-(1,2-diethylbenzimidazol-5-yl)-1-methylindole-6-carboxamide.
| Compound Name | N-(1,2-diethylbenzimidazol-5-yl)-1-methylindole-6-carboxamide |
|---|---|
| PubChem CID | 131947501 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | N-(1,2-diethylbenzimidazol-5-yl)-1-methylindole-6-carboxamide |
| SMILES | CCc1nc2cc(NC(=O)c3ccc4ccn(C)c4c3)ccc2n1CC |
| InChI | InChI=1S/C21H22N4O/c1-4-20-23-17-13-16(8-9-18(17)25(20)5-2)22-21(26)15-7-6-14-10-11-24(3)19(14)12-15/h6-13H,4-5H2,1-3H3,(H,22,26) |
| InChIKey | FCCSGVWWTRVTME-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |