About (3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone
(3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone (PubChem CID 131948105) has the molecular formula C16H22N4O2
and a molecular weight of 302.38 g/mol. Its IUPAC name is (3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | (3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone |
| PubChem CID | 131948105 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone |
| SMILES | CC(C)C1=NOC(C(=O)N2CCN(c3ccncc3)CC2)C1 |
| InChI | InChI=1S/C16H22N4O2/c1-12(2)14-11-15(22-18-14)16(21)20-9-7-19(8-10-20)13-3-5-17-6-4-13/h3-6,12,15H,7-11H2,1-2H3 |
| InChIKey | UJAIZTZYOBCEAM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 58.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone?
The IUPAC name of (3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone (CID 131948105) is (3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone.
What is the SMILES notation for (3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone?
The canonical SMILES for (3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone is CC(C)C1=NOC(C(=O)N2CCN(c3ccncc3)CC2)C1.
What is the InChIKey of (3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone?
The InChIKey is UJAIZTZYOBCEAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4O2/c1-12(2)14-11-15(22-18-14)16(21)20-9-7-19(8-10-20)13-3-5-17-6-4-13/h3-6,12,15H,7-11H2,1-2H3.
What are the key properties of (3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone?
(3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone has a molecular weight of 302.38 g/mol, XLogP of 1.53, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-propan-2-yl-4,5-dihydro-1,2-oxazol-5-yl)-(4-pyridin-4-ylpiperazin-1-yl)methanone is sourced from PubChem (CID 131948105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).