C20H22N4O4S — CID 131948129
N-[1-(furan-2-carbonyl)piperidin-3-yl]-2-methyl-5-pyrazol-1-ylbenzenesulfonamide (PubChem CID 131948129) has the molecular formula C20H22N4O4S and a molecular weight of 414.49 g/mol. Its IUPAC name is N-[1-(furan-2-carbonyl)piperidin-3-yl]-2-methyl-5-pyrazol-1-ylbenzenesulfonamide.
| Compound Name | N-[1-(furan-2-carbonyl)piperidin-3-yl]-2-methyl-5-pyrazol-1-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 131948129 |
| Molecular Formula | C20H22N4O4S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | N-[1-(furan-2-carbonyl)piperidin-3-yl]-2-methyl-5-pyrazol-1-ylbenzenesulfonamide |
| SMILES | Cc1ccc(-n2cccn2)cc1S(=O)(=O)NC1CCCN(C(=O)c2ccco2)C1 |
| InChI | InChI=1S/C20H22N4O4S/c1-15-7-8-17(24-11-4-9-21-24)13-19(15)29(26,27)22-16-5-2-10-23(14-16)20(25)18-6-3-12-28-18/h3-4,6-9,11-13,16,22H,2,5,10,14H2,1H3 |
| InChIKey | DWSHEWDGXKOHOU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |